C6H7Br2N3O3 — CID 134862838
1-(2,5-dibromo-4-nitroimidazol-1-yl)propan-2-ol (PubChem CID 134862838) has the molecular formula C6H7Br2N3O3 and a molecular weight of 328.95 g/mol. Its IUPAC name is 1-(2,5-dibromo-4-nitroimidazol-1-yl)propan-2-ol.
| Compound Name | 1-(2,5-dibromo-4-nitroimidazol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 134862838 |
| Molecular Formula | C6H7Br2N3O3 |
| Molecular Weight | 328.95 g/mol |
| Exact Mass | 326.89 |
| IUPAC Name | 1-(2,5-dibromo-4-nitroimidazol-1-yl)propan-2-ol |
| SMILES | CC(O)Cn1c(Br)nc([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C6H7Br2N3O3/c1-3(12)2-10-4(7)5(11(13)14)9-6(10)8/h3,12H,2H2,1H3 |
| InChIKey | CPZXBIGCGRCXGW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.95 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|