C9H13N3O5 — CID 63799076
1-ethyl-3-(2-hydroxypropyl)-5-nitropyrimidine-2,4-dione (PubChem CID 63799076) has the molecular formula C9H13N3O5 and a molecular weight of 243.22 g/mol. Its IUPAC name is 1-ethyl-3-(2-hydroxypropyl)-5-nitropyrimidine-2,4-dione.
| Compound Name | 1-ethyl-3-(2-hydroxypropyl)-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63799076 |
| Molecular Formula | C9H13N3O5 |
| Molecular Weight | 243.22 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 1-ethyl-3-(2-hydroxypropyl)-5-nitropyrimidine-2,4-dione |
| SMILES | CCn1cc([N+](=O)[O-])c(=O)n(CC(C)O)c1=O |
| InChI | InChI=1S/C9H13N3O5/c1-3-10-5-7(12(16)17)8(14)11(9(10)15)4-6(2)13/h5-6,13H,3-4H2,1-2H3 |
| InChIKey | UWABMBYMSFBEON-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 107.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.22 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|