C9H12BrN3O4 — CID 63799747
3-(2-bromoethyl)-5-nitro-1-propylpyrimidine-2,4-dione (PubChem CID 63799747) has the molecular formula C9H12BrN3O4 and a molecular weight of 306.12 g/mol. Its IUPAC name is 3-(2-bromoethyl)-5-nitro-1-propylpyrimidine-2,4-dione.
| Compound Name | 3-(2-bromoethyl)-5-nitro-1-propylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63799747 |
| Molecular Formula | C9H12BrN3O4 |
| Molecular Weight | 306.12 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 3-(2-bromoethyl)-5-nitro-1-propylpyrimidine-2,4-dione |
| SMILES | CCCn1cc([N+](=O)[O-])c(=O)n(CCBr)c1=O |
| InChI | InChI=1S/C9H12BrN3O4/c1-2-4-11-6-7(13(16)17)8(14)12(5-3-10)9(11)15/h6H,2-5H2,1H3 |
| InChIKey | ADRPXJLHQSYCHY-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|