C16H19N3O4 — CID 142683825
1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 142683825) has the molecular formula C16H19N3O4 and a molecular weight of 317.34 g/mol. Its IUPAC name is 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142683825 |
| Molecular Formula | C16H19N3O4 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 1-(2-methylpropyl)-5-nitro-3-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | CC(C)Cn1cc([N+](=O)[O-])c(=O)n(CCc2ccccc2)c1=O |
| InChI | InChI=1S/C16H19N3O4/c1-12(2)10-17-11-14(19(22)23)15(20)18(16(17)21)9-8-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3 |
| InChIKey | JFFGDEWFQPCJJL-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|