C9H14N4O5 — CID 63800983
3-(3-amino-2-hydroxypropyl)-1-ethyl-5-nitropyrimidine-2,4-dione (PubChem CID 63800983) has the molecular formula C9H14N4O5 and a molecular weight of 258.23 g/mol. Its IUPAC name is 3-(3-amino-2-hydroxypropyl)-1-ethyl-5-nitropyrimidine-2,4-dione.
| Compound Name | 3-(3-amino-2-hydroxypropyl)-1-ethyl-5-nitropyrimidine-2,4-dione |
|---|---|
| PubChem CID | 63800983 |
| Molecular Formula | C9H14N4O5 |
| Molecular Weight | 258.23 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 3-(3-amino-2-hydroxypropyl)-1-ethyl-5-nitropyrimidine-2,4-dione |
| SMILES | CCn1cc([N+](=O)[O-])c(=O)n(CC(O)CN)c1=O |
| InChI | InChI=1S/C9H14N4O5/c1-2-11-5-7(13(17)18)8(15)12(9(11)16)4-6(14)3-10/h5-6,14H,2-4,10H2,1H3 |
| InChIKey | PTOPBSSUJVXNSC-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.23 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|