C17H23Br2N7O2 — CID 118524557
5,6-dibromo-4-nitro-2-piperazin-1-yl-1-(2-piperazin-1-ylethyl)benzimidazole (PubChem CID 118524557) has the molecular formula C17H23Br2N7O2 and a molecular weight of 517.23 g/mol. Its IUPAC name is 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-(2-piperazin-1-ylethyl)benzimidazole.
| Compound Name | 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-(2-piperazin-1-ylethyl)benzimidazole |
|---|---|
| PubChem CID | 118524557 |
| Molecular Formula | C17H23Br2N7O2 |
| Molecular Weight | 517.23 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | 5,6-dibromo-4-nitro-2-piperazin-1-yl-1-(2-piperazin-1-ylethyl)benzimidazole |
| SMILES | O=[N+]([O-])c1c(Br)c(Br)cc2c1nc(N1CCNCC1)n2CCN1CCNCC1 |
| InChI | InChI=1S/C17H23Br2N7O2/c18-12-11-13-15(16(14(12)19)26(27)28)22-17(24-7-3-21-4-8-24)25(13)10-9-23-5-1-20-2-6-23/h11,20-21H,1-10H2 |
| InChIKey | KEFZTQCRCZHIBL-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.23 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|