C13H16Cl3N5O2 — CID 135144731
5,6-dichloro-1-ethyl-4-nitro-2-piperazin-1-ylbenzimidazole;hydrochloride (PubChem CID 135144731) has the molecular formula C13H16Cl3N5O2 and a molecular weight of 380.66 g/mol. Its IUPAC name is 5,6-dichloro-1-ethyl-4-nitro-2-piperazin-1-ylbenzimidazole;hydrochloride.
| Compound Name | 5,6-dichloro-1-ethyl-4-nitro-2-piperazin-1-ylbenzimidazole;hydrochloride |
|---|---|
| PubChem CID | 135144731 |
| Molecular Formula | C13H16Cl3N5O2 |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 5,6-dichloro-1-ethyl-4-nitro-2-piperazin-1-ylbenzimidazole;hydrochloride |
| SMILES | CCn1c(N2CCNCC2)nc2c([N+](=O)[O-])c(Cl)c(Cl)cc21.Cl |
| InChI | InChI=1S/C13H15Cl2N5O2.ClH/c1-2-19-9-7-8(14)10(15)12(20(21)22)11(9)17-13(19)18-5-3-16-4-6-18;/h7,16H,2-6H2,1H3;1H |
| InChIKey | ZWCFFSLCFYIGLL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|