C16H23N5O2 — CID 135161128
5,6-dimethyl-4-nitro-2-piperazin-1-yl-1-propan-2-ylbenzimidazole (PubChem CID 135161128) has the molecular formula C16H23N5O2 and a molecular weight of 317.39 g/mol. Its IUPAC name is 5,6-dimethyl-4-nitro-2-piperazin-1-yl-1-propan-2-ylbenzimidazole.
| Compound Name | 5,6-dimethyl-4-nitro-2-piperazin-1-yl-1-propan-2-ylbenzimidazole |
|---|---|
| PubChem CID | 135161128 |
| Molecular Formula | C16H23N5O2 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 5,6-dimethyl-4-nitro-2-piperazin-1-yl-1-propan-2-ylbenzimidazole |
| SMILES | Cc1cc2c(nc(N3CCNCC3)n2C(C)C)c([N+](=O)[O-])c1C |
| InChI | InChI=1S/C16H23N5O2/c1-10(2)20-13-9-11(3)12(4)15(21(22)23)14(13)18-16(20)19-7-5-17-6-8-19/h9-10,17H,5-8H2,1-4H3 |
| InChIKey | DDLGOAWAHFDXQF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 76.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|