C15H19Br2N5O2 — CID 90242359
(3S)-1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine (PubChem CID 90242359) has the molecular formula C15H19Br2N5O2 and a molecular weight of 461.16 g/mol. Its IUPAC name is (3S)-1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine.
| Compound Name | (3S)-1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine |
|---|---|
| PubChem CID | 90242359 |
| Molecular Formula | C15H19Br2N5O2 |
| Molecular Weight | 461.16 g/mol |
| Exact Mass | 458.99 |
| IUPAC Name | (3S)-1-(5,6-dibromo-4-nitro-1-propan-2-ylbenzimidazol-2-yl)piperidin-3-amine |
| SMILES | CC(C)n1c(N2CCC[C@H](N)C2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C15H19Br2N5O2/c1-8(2)21-11-6-10(16)12(17)14(22(23)24)13(11)19-15(21)20-5-3-4-9(18)7-20/h6,8-9H,3-5,7,18H2,1-2H3/t9-/m0/s1 |
| InChIKey | VGSFXLOOCLYWJD-VIFPVBQESA-N |
| XLogP | 3.98 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.16 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|