C14H17Br2N5O2 — CID 135144683
(3R)-1-(5,6-dibromo-4-nitro-1-propylbenzimidazol-2-yl)pyrrolidin-3-amine (PubChem CID 135144683) has the molecular formula C14H17Br2N5O2 and a molecular weight of 447.13 g/mol. Its IUPAC name is (3R)-1-(5,6-dibromo-4-nitro-1-propylbenzimidazol-2-yl)pyrrolidin-3-amine.
| Compound Name | (3R)-1-(5,6-dibromo-4-nitro-1-propylbenzimidazol-2-yl)pyrrolidin-3-amine |
|---|---|
| PubChem CID | 135144683 |
| Molecular Formula | C14H17Br2N5O2 |
| Molecular Weight | 447.13 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | (3R)-1-(5,6-dibromo-4-nitro-1-propylbenzimidazol-2-yl)pyrrolidin-3-amine |
| SMILES | CCCn1c(N2CC[C@@H](N)C2)nc2c([N+](=O)[O-])c(Br)c(Br)cc21 |
| InChI | InChI=1S/C14H17Br2N5O2/c1-2-4-20-10-6-9(15)11(16)13(21(22)23)12(10)18-14(20)19-5-3-8(17)7-19/h6,8H,2-5,7,17H2,1H3/t8-/m1/s1 |
| InChIKey | UFHHAGQPYUKUGY-MRVPVSSYSA-N |
| XLogP | 3.42 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|