C16H19Br2N5O2 — CID 135144740
(3R)-1-[5,6-dibromo-1-(cyclopropylmethyl)-4-nitrobenzimidazol-2-yl]piperidin-3-amine (PubChem CID 135144740) has the molecular formula C16H19Br2N5O2 and a molecular weight of 473.17 g/mol. Its IUPAC name is (3R)-1-[5,6-dibromo-1-(cyclopropylmethyl)-4-nitrobenzimidazol-2-yl]piperidin-3-amine.
| Compound Name | (3R)-1-[5,6-dibromo-1-(cyclopropylmethyl)-4-nitrobenzimidazol-2-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 135144740 |
| Molecular Formula | C16H19Br2N5O2 |
| Molecular Weight | 473.17 g/mol |
| Exact Mass | 470.99 |
| IUPAC Name | (3R)-1-[5,6-dibromo-1-(cyclopropylmethyl)-4-nitrobenzimidazol-2-yl]piperidin-3-amine |
| SMILES | N[C@@H]1CCCN(c2nc3c([N+](=O)[O-])c(Br)c(Br)cc3n2CC2CC2)C1 |
| InChI | InChI=1S/C16H19Br2N5O2/c17-11-6-12-14(15(13(11)18)23(24)25)20-16(22(12)7-9-3-4-9)21-5-1-2-10(19)8-21/h6,9-10H,1-5,7-8,19H2/t10-/m1/s1 |
| InChIKey | TVRGOAWUMYFAFF-SNVBAGLBSA-N |
| XLogP | 3.81 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.17 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|