C16H20Br2N4O3 — CID 152946581
5,6-dibromo-N-(2-methoxycyclopentyl)-4-nitro-1-propan-2-ylbenzimidazol-2-amine (PubChem CID 152946581) has the molecular formula C16H20Br2N4O3 and a molecular weight of 476.17 g/mol. Its IUPAC name is 5,6-dibromo-N-(2-methoxycyclopentyl)-4-nitro-1-propan-2-ylbenzimidazol-2-amine.
| Compound Name | 5,6-dibromo-N-(2-methoxycyclopentyl)-4-nitro-1-propan-2-ylbenzimidazol-2-amine |
|---|---|
| PubChem CID | 152946581 |
| Molecular Formula | C16H20Br2N4O3 |
| Molecular Weight | 476.17 g/mol |
| Exact Mass | 473.99 |
| IUPAC Name | 5,6-dibromo-N-(2-methoxycyclopentyl)-4-nitro-1-propan-2-ylbenzimidazol-2-amine |
| SMILES | COC1CCCC1Nc1nc2c([N+](=O)[O-])c(Br)c(Br)cc2n1C(C)C |
| InChI | InChI=1S/C16H20Br2N4O3/c1-8(2)21-11-7-9(17)13(18)15(22(23)24)14(11)20-16(21)19-10-5-4-6-12(10)25-3/h7-8,10,12H,4-6H2,1-3H3,(H,19,20) |
| InChIKey | HJRYBGCGEREOHA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 82.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.17 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|