C20H21Br2N3O4 — CID 12982433
2,7-dibromo-9-(2-ethylhexyl)-3,6-dinitrocarbazole (PubChem CID 12982433) has the molecular formula C20H21Br2N3O4 and a molecular weight of 527.21 g/mol. Its IUPAC name is 2,7-dibromo-9-(2-ethylhexyl)-3,6-dinitrocarbazole.
| Compound Name | 2,7-dibromo-9-(2-ethylhexyl)-3,6-dinitrocarbazole |
|---|---|
| PubChem CID | 12982433 |
| Molecular Formula | C20H21Br2N3O4 |
| Molecular Weight | 527.21 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | 2,7-dibromo-9-(2-ethylhexyl)-3,6-dinitrocarbazole |
| SMILES | CCCCC(CC)Cn1c2cc(Br)c([N+](=O)[O-])cc2c2cc([N+](=O)[O-])c(Br)cc21 |
| InChI | InChI=1S/C20H21Br2N3O4/c1-3-5-6-12(4-2)11-23-17-9-15(21)19(24(26)27)7-13(17)14-8-20(25(28)29)16(22)10-18(14)23/h7-10,12H,3-6,11H2,1-2H3 |
| InChIKey | MODUVLWSCZPWBB-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 91.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.21 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|