C20H21Cl2N5O — CID 70341723
3-[(2-aminophenyl)methyl]-2-[(3R)-3-aminopiperidin-1-yl]-6,8-dichloroquinazolin-4-one (PubChem CID 70341723) has the molecular formula C20H21Cl2N5O and a molecular weight of 418.33 g/mol. Its IUPAC name is 3-[(2-aminophenyl)methyl]-2-[(3R)-3-aminopiperidin-1-yl]-6,8-dichloroquinazolin-4-one.
| Compound Name | 3-[(2-aminophenyl)methyl]-2-[(3R)-3-aminopiperidin-1-yl]-6,8-dichloroquinazolin-4-one |
|---|---|
| PubChem CID | 70341723 |
| Molecular Formula | C20H21Cl2N5O |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.11 |
| IUPAC Name | 3-[(2-aminophenyl)methyl]-2-[(3R)-3-aminopiperidin-1-yl]-6,8-dichloroquinazolin-4-one |
| SMILES | Nc1ccccc1Cn1c(N2CCC[C@@H](N)C2)nc2c(Cl)cc(Cl)cc2c1=O |
| InChI | InChI=1S/C20H21Cl2N5O/c21-13-8-15-18(16(22)9-13)25-20(26-7-3-5-14(23)11-26)27(19(15)28)10-12-4-1-2-6-17(12)24/h1-2,4,6,8-9,14H,3,5,7,10-11,23-24H2/t14-/m1/s1 |
| InChIKey | QSIQEIPNKCLLHR-CQSZACIVSA-N |
| XLogP | 3.26 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|