C10H3ClF3N3O5 — CID 135854584
6-chloro-4-hydroxy-5-nitro-3-nitroso-7-(trifluoromethyl)-1H-quinolin-2-one (PubChem CID 135854584) has the molecular formula C10H3ClF3N3O5 and a molecular weight of 337.60 g/mol. Its IUPAC name is 6-chloro-4-hydroxy-5-nitro-3-nitroso-7-(trifluoromethyl)-1H-quinolin-2-one.
| Compound Name | 6-chloro-4-hydroxy-5-nitro-3-nitroso-7-(trifluoromethyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 135854584 |
| Molecular Formula | C10H3ClF3N3O5 |
| Molecular Weight | 337.60 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | 6-chloro-4-hydroxy-5-nitro-3-nitroso-7-(trifluoromethyl)-1H-quinolin-2-one |
| SMILES | O=Nc1c(O)c2c([N+](=O)[O-])c(Cl)c(C(F)(F)F)cc2[nH]c1=O |
| InChI | InChI=1S/C10H3ClF3N3O5/c11-5-2(10(12,13)14)1-3-4(7(5)17(21)22)8(18)6(16-20)9(19)15-3/h1H,(H2,15,18,19) |
| InChIKey | OEEPOBHZMIMOAR-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 125.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.60 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|