About 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium
3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium (PubChem CID 169126136) has the molecular formula C7H3F3N2O5Re
and a molecular weight of 438.31 g/mol. Its IUPAC name is 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium.
Molecular Properties
| Compound Name | 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium |
| PubChem CID | 169126136 |
| Molecular Formula | C7H3F3N2O5Re |
| Molecular Weight | 438.31 g/mol |
| Exact Mass | 438.96 |
| IUPAC Name | 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium |
| SMILES | O=C(O)c1[nH]c(=O)c(C(F)(F)F)cc1[N+](=O)[O-].[Re] |
| InChI | InChI=1S/C7H3F3N2O5.Re/c8-7(9,10)2-1-3(12(16)17)4(6(14)15)11-5(2)13;/h1H,(H,11,13)(H,14,15); |
| InChIKey | GSTIGFXZNGMJJE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium?
The IUPAC name of 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium (CID 169126136) is 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium.
What is the SMILES notation for 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium?
The canonical SMILES for 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium is O=C(O)c1[nH]c(=O)c(C(F)(F)F)cc1[N+](=O)[O-].[Re].
What is the InChIKey of 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium?
The InChIKey is GSTIGFXZNGMJJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H3F3N2O5.Re/c8-7(9,10)2-1-3(12(16)17)4(6(14)15)11-5(2)13;/h1H,(H,11,13)(H,14,15);.
What are the key properties of 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium?
3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium has a molecular weight of 438.31 g/mol, XLogP of 1.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carboxylic acid;rhenium is sourced from PubChem (CID 169126136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).