C7H5F3N4O4 — CID 175456068
3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carbohydrazide (PubChem CID 175456068) has the molecular formula C7H5F3N4O4 and a molecular weight of 266.13 g/mol. Its IUPAC name is 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carbohydrazide.
| Compound Name | 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 175456068 |
| Molecular Formula | C7H5F3N4O4 |
| Molecular Weight | 266.13 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 3-nitro-6-oxo-5-(trifluoromethyl)-1H-pyridine-2-carbohydrazide |
| SMILES | NNC(=O)c1[nH]c(=O)c(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C7H5F3N4O4/c8-7(9,10)2-1-3(14(17)18)4(6(16)13-11)12-5(2)15/h1H,11H2,(H,12,15)(H,13,16) |
| InChIKey | WPIGLSBAFWUQDQ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.13 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|