C10H4ClF6N5O5 — CID 159411716
4-chloro-5-nitro-2-(trifluoromethyl)-1H-pyrimidin-6-one;4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 159411716) has the molecular formula C10H4ClF6N5O5 and a molecular weight of 423.61 g/mol. Its IUPAC name is 4-chloro-5-nitro-2-(trifluoromethyl)-1H-pyrimidin-6-one;4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one.
| Compound Name | 4-chloro-5-nitro-2-(trifluoromethyl)-1H-pyrimidin-6-one;4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 159411716 |
| Molecular Formula | C10H4ClF6N5O5 |
| Molecular Weight | 423.61 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 4-chloro-5-nitro-2-(trifluoromethyl)-1H-pyrimidin-6-one;4-hydroxy-2-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(C(F)(F)F)nc(Cl)c1[N+](=O)[O-].O=c1cc(O)nc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C5HClF3N3O3.C5H3F3N2O2/c6-2-1(12(14)15)3(13)11-4(10-2)5(7,8)9;6-5(7,8)4-9-2(11)1-3(12)10-4/h(H,10,11,13);1H,(H2,9,10,11,12) |
| InChIKey | LOQSGBPHDHBAGJ-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 154.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.61 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|