C9H2F6N4O4 — CID 159332947
4,7-dinitro-2,6-bis(trifluoromethyl)-1H-benzimidazole (PubChem CID 159332947) has the molecular formula C9H2F6N4O4 and a molecular weight of 344.13 g/mol. Its IUPAC name is 4,7-dinitro-2,6-bis(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 4,7-dinitro-2,6-bis(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 159332947 |
| Molecular Formula | C9H2F6N4O4 |
| Molecular Weight | 344.13 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 4,7-dinitro-2,6-bis(trifluoromethyl)-1H-benzimidazole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)c([N+](=O)[O-])c2[nH]c(C(F)(F)F)nc12 |
| InChI | InChI=1S/C9H2F6N4O4/c10-8(11,12)2-1-3(18(20)21)4-5(6(2)19(22)23)17-7(16-4)9(13,14)15/h1H,(H,16,17) |
| InChIKey | SOHVDXNYSYPQRE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.13 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|