C11H9F3N4O5 — CID 21489353
4,6-dinitro-7-propan-2-yloxy-2-(trifluoromethyl)-1H-benzimidazole (PubChem CID 21489353) has the molecular formula C11H9F3N4O5 and a molecular weight of 334.21 g/mol. Its IUPAC name is 4,6-dinitro-7-propan-2-yloxy-2-(trifluoromethyl)-1H-benzimidazole.
| Compound Name | 4,6-dinitro-7-propan-2-yloxy-2-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| PubChem CID | 21489353 |
| Molecular Formula | C11H9F3N4O5 |
| Molecular Weight | 334.21 g/mol |
| Exact Mass | 334.05 |
| IUPAC Name | 4,6-dinitro-7-propan-2-yloxy-2-(trifluoromethyl)-1H-benzimidazole |
| SMILES | CC(C)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])c2nc(C(F)(F)F)[nH]c12 |
| InChI | InChI=1S/C11H9F3N4O5/c1-4(2)23-9-6(18(21)22)3-5(17(19)20)7-8(9)16-10(15-7)11(12,13)14/h3-4H,1-2H3,(H,15,16) |
| InChIKey | RXVVHRMPTULXRT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 124.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.21 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|