C8H5Br2N3O2 — CID 10782983
5,6-dibromo-2-methyl-4-nitro-1H-benzimidazole (PubChem CID 10782983) has the molecular formula C8H5Br2N3O2 and a molecular weight of 334.96 g/mol. Its IUPAC name is 5,6-dibromo-2-methyl-4-nitro-1H-benzimidazole.
| Compound Name | 5,6-dibromo-2-methyl-4-nitro-1H-benzimidazole |
|---|---|
| PubChem CID | 10782983 |
| Molecular Formula | C8H5Br2N3O2 |
| Molecular Weight | 334.96 g/mol |
| Exact Mass | 332.87 |
| IUPAC Name | 5,6-dibromo-2-methyl-4-nitro-1H-benzimidazole |
| SMILES | Cc1nc2c([N+](=O)[O-])c(Br)c(Br)cc2[nH]1 |
| InChI | InChI=1S/C8H5Br2N3O2/c1-3-11-5-2-4(9)6(10)8(13(14)15)7(5)12-3/h2H,1H3,(H,11,12) |
| InChIKey | YTVJLBKSWJOFNZ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.96 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|