C10H14ClN5O4 — CID 20509646
2-chloro-3-N,3-N-diethyl-4,6-dinitrobenzene-1,3,5-triamine (PubChem CID 20509646) has the molecular formula C10H14ClN5O4 and a molecular weight of 303.71 g/mol. Its IUPAC name is 2-chloro-3-N,3-N-diethyl-4,6-dinitrobenzene-1,3,5-triamine.
| Compound Name | 2-chloro-3-N,3-N-diethyl-4,6-dinitrobenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 20509646 |
| Molecular Formula | C10H14ClN5O4 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 2-chloro-3-N,3-N-diethyl-4,6-dinitrobenzene-1,3,5-triamine |
| SMILES | CCN(CC)c1c(Cl)c(N)c([N+](=O)[O-])c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H14ClN5O4/c1-3-14(4-2)8-5(11)6(12)9(15(17)18)7(13)10(8)16(19)20/h3-4,12-13H2,1-2H3 |
| InChIKey | XDNQHOZEEDJLSE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 141.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|