C12H4N12O16 — CID 90990770
4-[(4-amino-2,3,5,6-tetranitrophenyl)diazenyl]-2,3,5,6-tetranitroaniline (PubChem CID 90990770) has the molecular formula C12H4N12O16 and a molecular weight of 572.23 g/mol. Its IUPAC name is 4-[(4-amino-2,3,5,6-tetranitrophenyl)diazenyl]-2,3,5,6-tetranitroaniline.
| Compound Name | 4-[(4-amino-2,3,5,6-tetranitrophenyl)diazenyl]-2,3,5,6-tetranitroaniline |
|---|---|
| PubChem CID | 90990770 |
| Molecular Formula | C12H4N12O16 |
| Molecular Weight | 572.23 g/mol |
| Exact Mass | 571.99 |
| IUPAC Name | 4-[(4-amino-2,3,5,6-tetranitrophenyl)diazenyl]-2,3,5,6-tetranitroaniline |
| SMILES | Nc1c([N+](=O)[O-])c([N+](=O)[O-])c(/N=N/c2c([N+](=O)[O-])c([N+](=O)[O-])c(N)c([N+](=O)[O-])c2[N+](=O)[O-])c([N+](=O)[O-])c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H4N12O16/c13-1-5(17(25)26)9(21(33)34)3(10(22(35)36)6(1)18(27)28)15-16-4-11(23(37)38)7(19(29)30)2(14)8(20(31)32)12(4)24(39)40/h13-14H2/b16-15+ |
| InChIKey | DKERBBQJLPXSNC-FOCLMDBBSA-N |
| XLogP | 2.53 |
| TPSA | 421.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|