C6N6O8 — CID 56844161
1,4-dinitro-2,3,5,6-tetranitrosobenzene (PubChem CID 56844161) has the molecular formula C6N6O8 and a molecular weight of 284.10 g/mol. Its IUPAC name is 1,4-dinitro-2,3,5,6-tetranitrosobenzene.
| Compound Name | 1,4-dinitro-2,3,5,6-tetranitrosobenzene |
|---|---|
| PubChem CID | 56844161 |
| Molecular Formula | C6N6O8 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1,4-dinitro-2,3,5,6-tetranitrosobenzene |
| SMILES | O=Nc1c(N=O)c([N+](=O)[O-])c(N=O)c(N=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6N6O8/c13-7-1-2(8-14)6(12(19)20)4(10-16)3(9-15)5(1)11(17)18 |
| InChIKey | GQFJOSZTYNEGGE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 204.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|