C7H11N9O8 — CID 175942996
5-amino-2,4,6-trinitrobenzene-1,3-diol;1,2-diaminoguanidine (PubChem CID 175942996) has the molecular formula C7H11N9O8 and a molecular weight of 349.22 g/mol. Its IUPAC name is 5-amino-2,4,6-trinitrobenzene-1,3-diol;1,2-diaminoguanidine.
| Compound Name | 5-amino-2,4,6-trinitrobenzene-1,3-diol;1,2-diaminoguanidine |
|---|---|
| PubChem CID | 175942996 |
| Molecular Formula | C7H11N9O8 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-amino-2,4,6-trinitrobenzene-1,3-diol;1,2-diaminoguanidine |
| SMILES | NN=C(N)NN.Nc1c([N+](=O)[O-])c(O)c([N+](=O)[O-])c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C6H4N4O8.CH7N5/c7-1-2(8(13)14)5(11)4(10(17)18)6(12)3(1)9(15)16;2-1(5-3)6-4/h11-12H,7H2;3-4H2,(H3,2,5,6) |
| InChIKey | SLYDAUPFKXEBAK-UHFFFAOYSA-N |
| XLogP | -1.96 |
| TPSA | 298.35 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | -1.96 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|