C13H18Cl2NO3S+ — CID 144910916
[1-(2,6-dichloro-4-methylphenyl)-2-nitroethoxy]-diethylsulfanium (PubChem CID 144910916) has the molecular formula C13H18Cl2NO3S+ and a molecular weight of 339.26 g/mol. Its IUPAC name is [1-(2,6-dichloro-4-methylphenyl)-2-nitroethoxy]-diethylsulfanium.
| Compound Name | [1-(2,6-dichloro-4-methylphenyl)-2-nitroethoxy]-diethylsulfanium |
|---|---|
| PubChem CID | 144910916 |
| Molecular Formula | C13H18Cl2NO3S+ |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 338.04 |
| IUPAC Name | [1-(2,6-dichloro-4-methylphenyl)-2-nitroethoxy]-diethylsulfanium |
| SMILES | CC[S+](CC)OC(C[N+](=O)[O-])c1c(Cl)cc(C)cc1Cl |
| InChI | InChI=1S/C13H18Cl2NO3S/c1-4-20(5-2)19-12(8-16(17)18)13-10(14)6-9(3)7-11(13)15/h6-7,12H,4-5,8H2,1-3H3/q+1 |
| InChIKey | QTZZTGUNHJZPAD-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|