C11H14INO5 — CID 10361576
1-iodo-2,5-dimethoxy-4-(1-methoxy-2-nitroethyl)benzene (PubChem CID 10361576) has the molecular formula C11H14INO5 and a molecular weight of 367.14 g/mol. Its IUPAC name is 1-iodo-2,5-dimethoxy-4-(1-methoxy-2-nitroethyl)benzene.
| Compound Name | 1-iodo-2,5-dimethoxy-4-(1-methoxy-2-nitroethyl)benzene |
|---|---|
| PubChem CID | 10361576 |
| Molecular Formula | C11H14INO5 |
| Molecular Weight | 367.14 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 1-iodo-2,5-dimethoxy-4-(1-methoxy-2-nitroethyl)benzene |
| SMILES | COc1cc(C(C[N+](=O)[O-])OC)c(OC)cc1I |
| InChI | InChI=1S/C11H14INO5/c1-16-9-5-8(12)10(17-2)4-7(9)11(18-3)6-13(14)15/h4-5,11H,6H2,1-3H3 |
| InChIKey | NDOMYROZKHAOHS-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.14 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|