C11H17ClINO2 — CID 175942347
(1R)-1-(4-iodo-2,5-dimethoxyphenyl)propan-1-amine;hydrochloride (PubChem CID 175942347) has the molecular formula C11H17ClINO2 and a molecular weight of 357.62 g/mol. Its IUPAC name is (1R)-1-(4-iodo-2,5-dimethoxyphenyl)propan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(4-iodo-2,5-dimethoxyphenyl)propan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 175942347 |
| Molecular Formula | C11H17ClINO2 |
| Molecular Weight | 357.62 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | (1R)-1-(4-iodo-2,5-dimethoxyphenyl)propan-1-amine;hydrochloride |
| SMILES | CC[C@@H](N)c1cc(OC)c(I)cc1OC.Cl |
| InChI | InChI=1S/C11H16INO2.ClH/c1-4-9(13)7-5-11(15-3)8(12)6-10(7)14-2;/h5-6,9H,4,13H2,1-3H3;1H/t9-;/m1./s1 |
| InChIKey | IRBWVZPRSVHOLQ-SBSPUUFOSA-N |
| XLogP | 3.14 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.62 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|