C9H10N2O4 — CID 54531140
1-(dinitromethyl)-3,5-dimethylbenzene (PubChem CID 54531140) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 1-(dinitromethyl)-3,5-dimethylbenzene.
| Compound Name | 1-(dinitromethyl)-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 54531140 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 1-(dinitromethyl)-3,5-dimethylbenzene |
| SMILES | Cc1cc(C)cc(C([N+](=O)[O-])[N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N2O4/c1-6-3-7(2)5-8(4-6)9(10(12)13)11(14)15/h3-5,9H,1-2H3 |
| InChIKey | WTWGVYMTGCQCFA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|