C9H9N3O6 — CID 54194560
1-(dinitromethyl)-3,5-dimethyl-2-nitrobenzene (PubChem CID 54194560) has the molecular formula C9H9N3O6 and a molecular weight of 255.19 g/mol. Its IUPAC name is 1-(dinitromethyl)-3,5-dimethyl-2-nitrobenzene.
| Compound Name | 1-(dinitromethyl)-3,5-dimethyl-2-nitrobenzene |
|---|---|
| PubChem CID | 54194560 |
| Molecular Formula | C9H9N3O6 |
| Molecular Weight | 255.19 g/mol |
| Exact Mass | 255.05 |
| IUPAC Name | 1-(dinitromethyl)-3,5-dimethyl-2-nitrobenzene |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(C([N+](=O)[O-])[N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H9N3O6/c1-5-3-6(2)8(10(13)14)7(4-5)9(11(15)16)12(17)18/h3-4,9H,1-2H3 |
| InChIKey | PKWPYEATRVUXEW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 129.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.19 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|