C13H12N2O3S — CID 2777758
2-(3,5-dimethyl-2-nitrophenyl)sulfanyl-1-oxidopyridin-1-ium (PubChem CID 2777758) has the molecular formula C13H12N2O3S and a molecular weight of 276.32 g/mol. Its IUPAC name is 2-(3,5-dimethyl-2-nitrophenyl)sulfanyl-1-oxidopyridin-1-ium.
| Compound Name | 2-(3,5-dimethyl-2-nitrophenyl)sulfanyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 2777758 |
| Molecular Formula | C13H12N2O3S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.06 |
| IUPAC Name | 2-(3,5-dimethyl-2-nitrophenyl)sulfanyl-1-oxidopyridin-1-ium |
| SMILES | Cc1cc(C)c([N+](=O)[O-])c(Sc2cccc[n+]2[O-])c1 |
| InChI | InChI=1S/C13H12N2O3S/c1-9-7-10(2)13(15(17)18)11(8-9)19-12-5-3-4-6-14(12)16/h3-8H,1-2H3 |
| InChIKey | WEPCMESFQXAKKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 70.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|