C8H10N2O2S — CID 10512161
2,6-dimethyl-4-methylsulfanyl-3-nitropyridine (PubChem CID 10512161) has the molecular formula C8H10N2O2S and a molecular weight of 198.25 g/mol. Its IUPAC name is 2,6-dimethyl-4-methylsulfanyl-3-nitropyridine.
| Compound Name | 2,6-dimethyl-4-methylsulfanyl-3-nitropyridine |
|---|---|
| PubChem CID | 10512161 |
| Molecular Formula | C8H10N2O2S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2,6-dimethyl-4-methylsulfanyl-3-nitropyridine |
| SMILES | CSc1cc(C)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C8H10N2O2S/c1-5-4-7(13-3)8(10(11)12)6(2)9-5/h4H,1-3H3 |
| InChIKey | CLBMSUVYAYDTJW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|