C11H16ClN3O4S — CID 20569595
4-(2,6-dimethyl-3-nitro-4-pyridinyl)-1,4-thiazinane 1,1-dioxide;hydrochloride (PubChem CID 20569595) has the molecular formula C11H16ClN3O4S and a molecular weight of 321.79 g/mol. Its IUPAC name is 4-(2,6-dimethyl-3-nitro-4-pyridinyl)-1,4-thiazinane 1,1-dioxide;hydrochloride.
| Compound Name | 4-(2,6-dimethyl-3-nitro-4-pyridinyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
|---|---|
| PubChem CID | 20569595 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 4-(2,6-dimethyl-3-nitro-4-pyridinyl)-1,4-thiazinane 1,1-dioxide;hydrochloride |
| SMILES | Cc1cc(N2CCS(=O)(=O)CC2)c([N+](=O)[O-])c(C)n1.Cl |
| InChI | InChI=1S/C11H15N3O4S.ClH/c1-8-7-10(11(14(15)16)9(2)12-8)13-3-5-19(17,18)6-4-13;/h7H,3-6H2,1-2H3;1H |
| InChIKey | NBEHEJFQEAKYBI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 93.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|