C11H11N3O4S — CID 164823081
4-(2-isocyano-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide (PubChem CID 164823081) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 4-(2-isocyano-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide.
| Compound Name | 4-(2-isocyano-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide |
|---|---|
| PubChem CID | 164823081 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 4-(2-isocyano-4-nitrophenyl)-1,4-thiazinane 1,1-dioxide |
| SMILES | [C-]#[N+]c1cc([N+](=O)[O-])ccc1N1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H11N3O4S/c1-12-10-8-9(14(15)16)2-3-11(10)13-4-6-19(17,18)7-5-13/h2-3,8H,4-7H2 |
| InChIKey | PQIGBJRVCOYTGT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 84.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|