C10H16N4O2S — CID 103739613
4-(1,1-dioxo-1,4-thiazepan-4-yl)-6-methylpyrimidin-2-amine (PubChem CID 103739613) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazepan-4-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(1,1-dioxo-1,4-thiazepan-4-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 103739613 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazepan-4-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCCS(=O)(=O)CC2)nc(N)n1 |
| InChI | InChI=1S/C10H16N4O2S/c1-8-7-9(13-10(11)12-8)14-3-2-5-17(15,16)6-4-14/h7H,2-6H2,1H3,(H2,11,12,13) |
| InChIKey | LCNXJKYQNWWZED-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |