C12H22ClN5 — CID 139084866
[1-(2-amino-6-methylpyrimidin-4-yl)piperidin-4-yl]-dimethylazanium chloride (PubChem CID 139084866) has the molecular formula C12H22ClN5 and a molecular weight of 271.80 g/mol. Its IUPAC name is [1-(2-amino-6-methylpyrimidin-4-yl)piperidin-4-yl]-dimethylazanium chloride.
| Compound Name | [1-(2-amino-6-methylpyrimidin-4-yl)piperidin-4-yl]-dimethylazanium chloride |
|---|---|
| PubChem CID | 139084866 |
| Molecular Formula | C12H22ClN5 |
| Molecular Weight | 271.80 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [1-(2-amino-6-methylpyrimidin-4-yl)piperidin-4-yl]-dimethylazanium chloride |
| SMILES | Cc1cc(N2CCC([NH+](C)C)CC2)nc(N)n1.[Cl-] |
| InChI | InChI=1S/C12H21N5.ClH/c1-9-8-11(15-12(13)14-9)17-6-4-10(5-7-17)16(2)3;/h8,10H,4-7H2,1-3H3,(H2,13,14,15);1H |
| InChIKey | OYRLQJLOOFJYCF-UHFFFAOYSA-N |
| XLogP | -3.52 |
| TPSA | 59.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.80 |
| LogP ≤ 5 | -3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |