C22H26N6 — CID 97187975
4-methyl-6-[4-[[(S)-phenyl(pyridin-4-yl)methyl]amino]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 97187975) has the molecular formula C22H26N6 and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-methyl-6-[4-[[(S)-phenyl(pyridin-4-yl)methyl]amino]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-methyl-6-[4-[[(S)-phenyl(pyridin-4-yl)methyl]amino]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 97187975 |
| Molecular Formula | C22H26N6 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.22 |
| IUPAC Name | 4-methyl-6-[4-[[(S)-phenyl(pyridin-4-yl)methyl]amino]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCC(N[C@@H](c3ccccc3)c3ccncc3)CC2)nc(N)n1 |
| InChI | InChI=1S/C22H26N6/c1-16-15-20(27-22(23)25-16)28-13-9-19(10-14-28)26-21(17-5-3-2-4-6-17)18-7-11-24-12-8-18/h2-8,11-12,15,19,21,26H,9-10,13-14H2,1H3,(H2,23,25,27)/t21-/m0/s1 |
| InChIKey | ZNDSEDMEHADSSR-NRFANRHFSA-N |
| XLogP | 3.11 |
| TPSA | 79.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |