C23H26N4O — CID 95552034
4-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-6-methylpyrimidin-2-amine (PubChem CID 95552034) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is 4-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 95552034 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | 4-[(2S)-2-(2,2-diphenylethyl)morpholin-4-yl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCO[C@@H](CC(c3ccccc3)c3ccccc3)C2)nc(N)n1 |
| InChI | InChI=1S/C23H26N4O/c1-17-14-22(26-23(24)25-17)27-12-13-28-20(16-27)15-21(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-11,14,20-21H,12-13,15-16H2,1H3,(H2,24,25,26)/t20-/m0/s1 |
| InChIKey | IIGLAUCIXAQMMW-FQEVSTJZSA-N |
| XLogP | 3.79 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |