C21H29N5O — CID 72845869
4-methyl-6-[4-[[1-(phenoxymethyl)cyclopropyl]methylamino]piperidin-1-yl]pyrimidin-2-amine (PubChem CID 72845869) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is 4-methyl-6-[4-[[1-(phenoxymethyl)cyclopropyl]methylamino]piperidin-1-yl]pyrimidin-2-amine.
| Compound Name | 4-methyl-6-[4-[[1-(phenoxymethyl)cyclopropyl]methylamino]piperidin-1-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 72845869 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | 4-methyl-6-[4-[[1-(phenoxymethyl)cyclopropyl]methylamino]piperidin-1-yl]pyrimidin-2-amine |
| SMILES | Cc1cc(N2CCC(NCC3(COc4ccccc4)CC3)CC2)nc(N)n1 |
| InChI | InChI=1S/C21H29N5O/c1-16-13-19(25-20(22)24-16)26-11-7-17(8-12-26)23-14-21(9-10-21)15-27-18-5-3-2-4-6-18/h2-6,13,17,23H,7-12,14-15H2,1H3,(H2,22,24,25) |
| InChIKey | NRXNQUIKVBKWSD-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 76.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |