C22H32N6 — CID 72916033
4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine (PubChem CID 72916033) has the molecular formula C22H32N6 and a molecular weight of 380.54 g/mol. Its IUPAC name is 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine.
| Compound Name | 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 72916033 |
| Molecular Formula | C22H32N6 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.27 |
| IUPAC Name | 4-[4-[3-(3,4-dihydro-2H-quinolin-1-yl)propylamino]piperidin-1-yl]-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCC(NCCCN3CCCc4ccccc43)CC2)nc(N)n1 |
| InChI | InChI=1S/C22H32N6/c1-17-16-21(26-22(23)25-17)28-14-9-19(10-15-28)24-11-5-13-27-12-4-7-18-6-2-3-8-20(18)27/h2-3,6,8,16,19,24H,4-5,7,9-15H2,1H3,(H2,23,25,26) |
| InChIKey | OSQYCWKFFASGRO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|