About [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol
[1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol (PubChem CID 56760178) has the molecular formula C18H25N5O2
and a molecular weight of 343.43 g/mol. Its IUPAC name is [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol.
Molecular Properties
| Compound Name | [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
| PubChem CID | 56760178 |
| Molecular Formula | C18H25N5O2 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.20 |
| IUPAC Name | [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol |
| SMILES | Nc1cc(N2CCC(CO)(CCOc3ccccc3)CC2)nc(N)n1 |
| InChI | InChI=1S/C18H25N5O2/c19-15-12-16(22-17(20)21-15)23-9-6-18(13-24,7-10-23)8-11-25-14-4-2-1-3-5-14/h1-5,12,24H,6-11,13H2,(H4,19,20,21,22) |
| InChIKey | AMADVCJIHVQRJI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The IUPAC name of [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol (CID 56760178) is [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol.
What is the SMILES notation for [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The canonical SMILES for [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol is Nc1cc(N2CCC(CO)(CCOc3ccccc3)CC2)nc(N)n1.
What is the InChIKey of [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
The InChIKey is AMADVCJIHVQRJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25N5O2/c19-15-12-16(22-17(20)21-15)23-9-6-18(13-24,7-10-23)8-11-25-14-4-2-1-3-5-14/h1-5,12,24H,6-11,13H2,(H4,19,20,21,22).
What are the key properties of [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol?
[1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol has a molecular weight of 343.43 g/mol, XLogP of 1.69, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,6-diaminopyrimidin-4-yl)-4-(2-phenoxyethyl)piperidin-4-yl]methanol is sourced from PubChem (CID 56760178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).