C18H23N3 — CID 61210102
1-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidin-3-amine (PubChem CID 61210102) has the molecular formula C18H23N3 and a molecular weight of 281.40 g/mol. Its IUPAC name is 1-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidin-3-amine.
| Compound Name | 1-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidin-3-amine |
|---|---|
| PubChem CID | 61210102 |
| Molecular Formula | C18H23N3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.19 |
| IUPAC Name | 1-methyl-N-[phenyl(pyridin-4-yl)methyl]piperidin-3-amine |
| SMILES | CN1CCCC(NC(c2ccccc2)c2ccncc2)C1 |
| InChI | InChI=1S/C18H23N3/c1-21-13-5-8-17(14-21)20-18(15-6-3-2-4-7-15)16-9-11-19-12-10-16/h2-4,6-7,9-12,17-18,20H,5,8,13-14H2,1H3 |
| InChIKey | YFXDXUUODQCDPN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |