C9H14N4O2S — CID 78928279
4-(1,1-dioxo-1,4-thiazinan-4-yl)-6-methylpyrimidin-2-amine (PubChem CID 78928279) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-(1,1-dioxo-1,4-thiazinan-4-yl)-6-methylpyrimidin-2-amine.
| Compound Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-6-methylpyrimidin-2-amine |
|---|---|
| PubChem CID | 78928279 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-(1,1-dioxo-1,4-thiazinan-4-yl)-6-methylpyrimidin-2-amine |
| SMILES | Cc1cc(N2CCS(=O)(=O)CC2)nc(N)n1 |
| InChI | InChI=1S/C9H14N4O2S/c1-7-6-8(12-9(10)11-7)13-2-4-16(14,15)5-3-13/h6H,2-5H2,1H3,(H2,10,11,12) |
| InChIKey | CPINRINHDXZVPL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |