C14H15NO2 — CID 140976101
1-oxido-2-(2,4,6-trimethylphenoxy)pyridin-1-ium (PubChem CID 140976101) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 1-oxido-2-(2,4,6-trimethylphenoxy)pyridin-1-ium.
| Compound Name | 1-oxido-2-(2,4,6-trimethylphenoxy)pyridin-1-ium |
|---|---|
| PubChem CID | 140976101 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 1-oxido-2-(2,4,6-trimethylphenoxy)pyridin-1-ium |
| SMILES | Cc1cc(C)c(Oc2cccc[n+]2[O-])c(C)c1 |
| InChI | InChI=1S/C14H15NO2/c1-10-8-11(2)14(12(3)9-10)17-13-6-4-5-7-15(13)16/h4-9H,1-3H3 |
| InChIKey | QEOMJZNFBYMYCI-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|