About iron;2-methoxy-1-oxidopyridin-1-ium
iron;2-methoxy-1-oxidopyridin-1-ium (PubChem CID 175100499) has the molecular formula C6H7FeNO2
and a molecular weight of 180.97 g/mol. Its IUPAC name is iron;2-methoxy-1-oxidopyridin-1-ium.
Molecular Properties
| Compound Name | iron;2-methoxy-1-oxidopyridin-1-ium |
| PubChem CID | 175100499 |
| Molecular Formula | C6H7FeNO2 |
| Molecular Weight | 180.97 g/mol |
| Exact Mass | 180.98 |
| IUPAC Name | iron;2-methoxy-1-oxidopyridin-1-ium |
| SMILES | COc1cccc[n+]1[O-].[Fe] |
| InChI | InChI=1S/C6H7NO2.Fe/c1-9-6-4-2-3-5-7(6)8;/h2-5H,1H3; |
| InChIKey | MXZLKTVRYHSGJW-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.97 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze iron;2-methoxy-1-oxidopyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iron;2-methoxy-1-oxidopyridin-1-ium?
The IUPAC name of iron;2-methoxy-1-oxidopyridin-1-ium (CID 175100499) is iron;2-methoxy-1-oxidopyridin-1-ium.
What is the SMILES notation for iron;2-methoxy-1-oxidopyridin-1-ium?
The canonical SMILES for iron;2-methoxy-1-oxidopyridin-1-ium is COc1cccc[n+]1[O-].[Fe].
What is the InChIKey of iron;2-methoxy-1-oxidopyridin-1-ium?
The InChIKey is MXZLKTVRYHSGJW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2.Fe/c1-9-6-4-2-3-5-7(6)8;/h2-5H,1H3;.
What are the key properties of iron;2-methoxy-1-oxidopyridin-1-ium?
iron;2-methoxy-1-oxidopyridin-1-ium has a molecular weight of 180.97 g/mol, XLogP of 0.33, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for iron;2-methoxy-1-oxidopyridin-1-ium is sourced from PubChem (CID 175100499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).