About mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride
mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride (PubChem CID 172885243) has the molecular formula C6H7Cl2HgNO2
and a molecular weight of 396.62 g/mol. Its IUPAC name is mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride.
Molecular Properties
| Compound Name | mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride |
| PubChem CID | 172885243 |
| Molecular Formula | C6H7Cl2HgNO2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.96 |
| IUPAC Name | mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride |
| SMILES | COc1cccc[n+]1[O-].[Cl-].[Cl-].[Hg+2] |
| InChI | InChI=1S/C6H7NO2.2ClH.Hg/c1-9-6-4-2-3-5-7(6)8;;;/h2-5H,1H3;2*1H;/q;;;+2/p-2 |
| InChIKey | VVWJGEHJJMSEOP-UHFFFAOYSA-L |
| XLogP | -5.67 |
| TPSA | 36.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | -5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride?
The IUPAC name of mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride (CID 172885243) is mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride.
What is the SMILES notation for mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride?
The canonical SMILES for mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride is COc1cccc[n+]1[O-].[Cl-].[Cl-].[Hg+2].
What is the InChIKey of mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride?
The InChIKey is VVWJGEHJJMSEOP-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7NO2.2ClH.Hg/c1-9-6-4-2-3-5-7(6)8;;;/h2-5H,1H3;2*1H;/q;;;+2/p-2.
What are the key properties of mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride?
mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride has a molecular weight of 396.62 g/mol, XLogP of -5.67, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(2+);2-methoxy-1-oxidopyridin-1-ium;dichloride is sourced from PubChem (CID 172885243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).