About 2-methyl-1-oxidopyridin-1-ium;pyridine
2-methyl-1-oxidopyridin-1-ium;pyridine (PubChem CID 160954375) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 2-methyl-1-oxidopyridin-1-ium;pyridine.
Molecular Properties
| Compound Name | 2-methyl-1-oxidopyridin-1-ium;pyridine |
| PubChem CID | 160954375 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 2-methyl-1-oxidopyridin-1-ium;pyridine |
| SMILES | Cc1cccc[n+]1[O-].c1ccncc1 |
| InChI | InChI=1S/C6H7NO.C5H5N/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5H,1H3;1-5H |
| InChIKey | SWENWGQHRDXDHX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 39.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-1-oxidopyridin-1-ium;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-oxidopyridin-1-ium;pyridine?
The IUPAC name of 2-methyl-1-oxidopyridin-1-ium;pyridine (CID 160954375) is 2-methyl-1-oxidopyridin-1-ium;pyridine.
What is the SMILES notation for 2-methyl-1-oxidopyridin-1-ium;pyridine?
The canonical SMILES for 2-methyl-1-oxidopyridin-1-ium;pyridine is Cc1cccc[n+]1[O-].c1ccncc1.
What is the InChIKey of 2-methyl-1-oxidopyridin-1-ium;pyridine?
The InChIKey is SWENWGQHRDXDHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO.C5H5N/c1-6-4-2-3-5-7(6)8;1-2-4-6-5-3-1/h2-5H,1H3;1-5H.
What are the key properties of 2-methyl-1-oxidopyridin-1-ium;pyridine?
2-methyl-1-oxidopyridin-1-ium;pyridine has a molecular weight of 188.23 g/mol, XLogP of 1.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-oxidopyridin-1-ium;pyridine is sourced from PubChem (CID 160954375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).