C13H12N2O4S — CID 139186753
1,1-dioxo-1,2-benzothiazol-3-one;2-methyl-1-oxidopyridin-1-ium (PubChem CID 139186753) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 1,1-dioxo-1,2-benzothiazol-3-one;2-methyl-1-oxidopyridin-1-ium.
| Compound Name | 1,1-dioxo-1,2-benzothiazol-3-one;2-methyl-1-oxidopyridin-1-ium |
|---|---|
| PubChem CID | 139186753 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 1,1-dioxo-1,2-benzothiazol-3-one;2-methyl-1-oxidopyridin-1-ium |
| SMILES | Cc1cccc[n+]1[O-].O=C1NS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C7H5NO3S.C6H7NO/c9-7-5-3-1-2-4-6(5)12(10,11)8-7;1-6-4-2-3-5-7(6)8/h1-4H,(H,8,9);2-5H,1H3 |
| InChIKey | QEZJDMUAGPJALR-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 90.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|