C7H2Br2N4O8 — CID 171384736
1,3-dibromo-5-(dinitromethyl)-2,4-dinitrobenzene (PubChem CID 171384736) has the molecular formula C7H2Br2N4O8 and a molecular weight of 429.92 g/mol. Its IUPAC name is 1,3-dibromo-5-(dinitromethyl)-2,4-dinitrobenzene.
| Compound Name | 1,3-dibromo-5-(dinitromethyl)-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 171384736 |
| Molecular Formula | C7H2Br2N4O8 |
| Molecular Weight | 429.92 g/mol |
| Exact Mass | 427.82 |
| IUPAC Name | 1,3-dibromo-5-(dinitromethyl)-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1c(Br)cc(C([N+](=O)[O-])[N+](=O)[O-])c([N+](=O)[O-])c1Br |
| InChI | InChI=1S/C7H2Br2N4O8/c8-3-1-2(7(12(18)19)13(20)21)5(10(14)15)4(9)6(3)11(16)17/h1,7H |
| InChIKey | JDQDWLGVRXZWMS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.92 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|