C16H5Br4NO2 — CID 172792221
1,3,6,8-tetrabromo-2-nitropyrene (PubChem CID 172792221) has the molecular formula C16H5Br4NO2 and a molecular weight of 562.84 g/mol. Its IUPAC name is 1,3,6,8-tetrabromo-2-nitropyrene.
| Compound Name | 1,3,6,8-tetrabromo-2-nitropyrene |
|---|---|
| PubChem CID | 172792221 |
| Molecular Formula | C16H5Br4NO2 |
| Molecular Weight | 562.84 g/mol |
| Exact Mass | 558.71 |
| IUPAC Name | 1,3,6,8-tetrabromo-2-nitropyrene |
| SMILES | O=[N+]([O-])c1c(Br)c2ccc3c(Br)cc(Br)c4ccc(c1Br)c2c34 |
| InChI | InChI=1S/C16H5Br4NO2/c17-10-5-11(18)7-2-4-9-13-8(3-1-6(10)12(7)13)14(19)16(15(9)20)21(22)23/h1-5H |
| InChIKey | PSMRUXTTYQVKFL-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.84 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|